CAS 60241-74-9 appears in our catalog under these names: 2,3,6-Trimethoxybenzoic acid, 98%, 2，3，6–Trimethoxybenzoic Acid, 2,3,6-Trimethoxybenzoic Acid, 2,3,6-Trimethoxybenzoic Acid, >98.0%(GC)(T), 2,3,6-Trimethoxybenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Chemat. Available pack sizes: 1g, 5g, 200mg, 250mg.
2,3,6-trimethoxybenzoic acid (CAS 60241-74-9) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: 2,3,6-trimethoxybenzoic acid. InChIKey: NSKSXYUOXAQHCH-UHFFFAOYSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2,3,6-trimethoxybenzoic acid |
| InChIKey | NSKSXYUOXAQHCH-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)OC)OC)C(=O)O |
Computed by PubChem (NCBI)