cas: 13985-15-4 — see every product listed under this CAS number, including other names
2,3,6,7-Tetramethoxy-9,10-dimethylanthracene, 97% (CAS 13985-15-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F547204-100MG |
| cas | 13985-15-4 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 133.30 Pln | |
| Fluorochem | 250mg | 232.23 Pln | |
| Fluorochem | 1g | 544.62 Pln | |
| Fluorochem | 5g | 2450.20 Pln | |
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 220.19 Pln | |
| Ambeed | 1g | 515.00 Pln | |
| Ambeed | 5g | 2289.44 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
2,3,6,7-tetramethoxy-9,10-dimethylanthracene (CAS 13985-15-4) is a chemical compound with the molecular formula C20H22O4 and a molecular weight of 326.4 g/mol. IUPAC name: 2,3,6,7-tetramethoxy-9,10-dimethylanthracene. InChIKey: FRIORIWMGKOZPB-UHFFFAOYSA-N.
| Molecular formula | C20H22O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 2,3,6,7-tetramethoxy-9,10-dimethylanthracene |
| InChIKey | FRIORIWMGKOZPB-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C(=CC2=C(C3=CC(=C(C=C13)OC)OC)C)OC)OC |
Computed by PubChem (NCBI)