CAS 13985-15-4 appears in our catalog under these names: 9,10-diMethyl-2,3,6,7-tetraMethoxy-anthracene, 97%, 97%, 2,3,6,7-Tetramethoxy-9,10-dimethylanthracene, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
2,3,6,7-tetramethoxy-9,10-dimethylanthracene (CAS 13985-15-4) is a chemical compound with the molecular formula C20H22O4 and a molecular weight of 326.4 g/mol. IUPAC name: 2,3,6,7-tetramethoxy-9,10-dimethylanthracene. InChIKey: FRIORIWMGKOZPB-UHFFFAOYSA-N.
| Molecular formula | C20H22O4 |
|---|---|
| Molecular weight | 326.4 g/mol |
| IUPAC name | 2,3,6,7-tetramethoxy-9,10-dimethylanthracene |
| InChIKey | FRIORIWMGKOZPB-UHFFFAOYSA-N |
| SMILES | CC1=C2C=C(C(=CC2=C(C3=CC(=C(C=C13)OC)OC)C)OC)OC |
Computed by PubChem (NCBI)