cas: 65078-77-5 — see every product listed under this CAS number, including other names
2,3-Dichloro-6-nitroaniline 97% (CAS 65078-77-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A142572-100mg |
| cas | 65078-77-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 181.25 Pln | |
| Ambeed | 1g | 281.38 Pln | |
| Ambeed | 5g | 648.50 Pln | |
| Ambeed | 10g | 1087.94 Pln | |
| Ambeed | 25g | 2061.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A142572 |
2,3-dichloro-6-nitroaniline (CAS 65078-77-5) is a chemical compound with the molecular formula C6H4Cl2N2O2 and a molecular weight of 207.01 g/mol. IUPAC name: 2,3-dichloro-6-nitroaniline. InChIKey: RDCOVUDTFKIURA-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O2 |
|---|---|
| Molecular weight | 207.01 g/mol |
| IUPAC name | 2,3-dichloro-6-nitroaniline |
| InChIKey | RDCOVUDTFKIURA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])N)Cl)Cl |
Computed by PubChem (NCBI)