2,3-Dichlorobenzamide 98%
cas: 5980-24-5 — see every product listed under this CAS number, including other names
2,3-Dichlorobenzamide 98% (CAS 5980-24-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A479997-1g |
| cas | 5980-24-5 |
| size | 1g |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 197.94 Pln | |
| Ambeed | 10g | 298.06 Pln | |
| Ambeed | 25g | 642.94 Pln | |
| Ambeed | 100g | 2000.19 Pln | |
| Ambeed | 500g | 7779.62 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A479997 |
2,3-dichlorobenzamide (CAS 5980-24-5) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: 2,3-dichlorobenzamide. InChIKey: KZKYRHRAVGWEAV-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | 2,3-dichlorobenzamide |
| InChIKey | KZKYRHRAVGWEAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)