CAS 5331-92-0 appears in our catalog under these names: 3,4-Dichlorobenzaldehyde oxime, 95%, 3,4-Dichlorobenzaldehyde oxime. Offered by: Combi-blocks, Biosynth, Fluorochem. Available pack sizes: 1g, 5g, 50g, 25g, 100g, 10g.
(NE)-N-[(3,4-dichlorophenyl)methylidene]hydroxylamine (CAS 5331-92-0) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: (NE)-N-[(3,4-dichlorophenyl)methylidene]hydroxylamine. InChIKey: ROBIUDOANJUDHD-ONNFQVAWSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | (NE)-N-[(3,4-dichlorophenyl)methylidene]hydroxylamine |
| InChIKey | ROBIUDOANJUDHD-ONNFQVAWSA-N |
| SMILES | C1=CC(=C(C=C1/C=N/O)Cl)Cl |
Computed by PubChem (NCBI)