CAS 5980-24-5 appears in our catalog under these names: 2,3-Dichlorobenzamide, 98%, 2,3-Dichlorobenzamide, 2,3-Dichlorobenzamide 98%, 2,3-Dichlorobenzamide, 98%, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 25g, 5g, 2g, 100g, 500g.
2,3-dichlorobenzamide (CAS 5980-24-5) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: 2,3-dichlorobenzamide. InChIKey: KZKYRHRAVGWEAV-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | 2,3-dichlorobenzamide |
| InChIKey | KZKYRHRAVGWEAV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=O)N |
Computed by PubChem (NCBI)