CAS 25185-95-9 appears in our catalog under these names: 2,6-Dichlorobenzaldehyde oxime, 97%, 2,6–Dichlorobenzaldoxime, 2,6-Dichlorobenzaldoxime/ 97+%, 2,6-Dichlorobenzaldoxime, 97% , 2,6-Dichlorobenzaldehyde oxime. Offered by: Combi-blocks, GLPBio, Chemat, Thermo Scientific (Alfa Aesar), Biosynth. Available pack sizes: 1g, 25g, 5g, 100g, 50g, 10g, 250g, 500g.
N-[(2,6-dichlorophenyl)methylidene]hydroxylamine (CAS 25185-95-9) is a chemical compound with the molecular formula C7H5Cl2NO and a molecular weight of 190.02 g/mol. IUPAC name: N-[(2,6-dichlorophenyl)methylidene]hydroxylamine. InChIKey: YBSXDWIAUZOFFV-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2NO |
|---|---|
| Molecular weight | 190.02 g/mol |
| IUPAC name | N-[(2,6-dichlorophenyl)methylidene]hydroxylamine |
| InChIKey | YBSXDWIAUZOFFV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C=NO)Cl |
Computed by PubChem (NCBI)