cas: 2905-60-4 — see every product listed under this CAS number, including other names
2,3-DichlorobenzoylChloride, 98%, 98% (CAS 2905-60-4) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113VBZ-25g |
| cas | 2905-60-4 |
| size | 25g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 88.40 Pln | |
| Chemat | 100g | 189.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,3-dichlorobenzoyl chloride (CAS 2905-60-4) is a chemical compound with the molecular formula C7H3Cl3O and a molecular weight of 209.5 g/mol. IUPAC name: 2,3-dichlorobenzoyl chloride. InChIKey: YBONBWJSFMTXLE-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 2,3-dichlorobenzoyl chloride |
| InChIKey | YBONBWJSFMTXLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=O)Cl |
Computed by PubChem (NCBI)