CAS 56961-75-2 appears in our catalog under these names: 2,3,5-Trichlorobenzaldehyde, 95%, 2,3,5–Trichlorobenzaldehyde, 2,3,5-Trichlorobenzaldehyde, 2,3,5-Trichlorobenzaldehyde, >95.0%(GC), 2,3,5-Trichlorobenzaldehyde 98%. Offered by: Combi-blocks, GLPBio, Biosynth, TCI, Ambeed. Available pack sizes: 5g, 100g, 25g, 10g, 1g, 50g, 250g, 250mg.
2,3,5-trichlorobenzaldehyde (CAS 56961-75-2) is a chemical compound with the molecular formula C7H3Cl3O and a molecular weight of 209.5 g/mol. IUPAC name: 2,3,5-trichlorobenzaldehyde. InChIKey: DJYRZTCLVDKWBL-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 2,3,5-trichlorobenzaldehyde |
| InChIKey | DJYRZTCLVDKWBL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1C=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)