CAS 35696-87-8 appears in our catalog under these names: 2,4,5-Trichlorobenzaldehyde, 98%, 98%, 2,4,5-Trichlorobenzaldehyde, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 250mg, 500mg.
2,4,5-trichlorobenzaldehyde (CAS 35696-87-8) is a chemical compound with the molecular formula C7H3Cl3O and a molecular weight of 209.5 g/mol. IUPAC name: 2,4,5-trichlorobenzaldehyde. InChIKey: LXQRQVUSDOKVLD-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 2,4,5-trichlorobenzaldehyde |
| InChIKey | LXQRQVUSDOKVLD-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1Cl)Cl)Cl)C=O |
Computed by PubChem (NCBI)