CAS 24473-00-5 appears in our catalog under these names: 2,4,6-Trichlorobenzaldehyde, 2,4,6–Trichlorobenzaldehyde, 2,4,6-Trichlorobenzaldehyde 97%, 2,4,6-Trichlorobenzaldehyde, 98%, 98%, 2,4,6-Trichlorobenzaldehyde, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 500mg, 10g, 5g, 25g, 100g, 500g.
2,4,6-trichlorobenzaldehyde (CAS 24473-00-5) is a chemical compound with the molecular formula C7H3Cl3O and a molecular weight of 209.5 g/mol. IUPAC name: 2,4,6-trichlorobenzaldehyde. InChIKey: TWFSYIOOAAYYAL-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 2,4,6-trichlorobenzaldehyde |
| InChIKey | TWFSYIOOAAYYAL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)C=O)Cl)Cl |
Computed by PubChem (NCBI)