CAS 89-75-8 appears in our catalog under these names: 2,4-Dichlorobenzoyl chloride, 97%, 2,4-Dichlorobenzoyl Chloride, 2,4-Dichlorobenzoyl Chloride, >97.0%(GC)(T), 2,4-Dichlorobenzoyl chloride, 98%, 2,4-Dichlorobenzene-1-carbonyl chloride, 97%. Offered by: Combi-blocks, TRC, Biosynth, TCI, Thermo Scientific (Acros). Available pack sizes: 100g, 25g, 250g, 0,5kg, 0,25kg, 500g, 5ML, 100ML.
2,4-dichlorobenzoyl chloride (CAS 89-75-8) is a chemical compound with the molecular formula C7H3Cl3O and a molecular weight of 209.5 g/mol. IUPAC name: 2,4-dichlorobenzoyl chloride. InChIKey: CEOCVKWBUWKBKA-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 2,4-dichlorobenzoyl chloride |
| InChIKey | CEOCVKWBUWKBKA-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(=O)Cl |
Computed by PubChem (NCBI)