CAS 4659-47-6 appears in our catalog under these names: 2,3,6-Trichlorobenzaldehyde, 95%, 2,3,6–Trichlorobenzaldehyde, 2,3,6-Trichlorobenzaldehyde, >97.0%(GC). Offered by: Combi-blocks, GLPBio, TCI, Fluorochem. Available pack sizes: 1g, 5g, 25g.
2,3,6-trichlorobenzaldehyde (CAS 4659-47-6) is a chemical compound with the molecular formula C7H3Cl3O and a molecular weight of 209.5 g/mol. IUPAC name: 2,3,6-trichlorobenzaldehyde. InChIKey: AURSMWWOMOVHBM-UHFFFAOYSA-N.
| Molecular formula | C7H3Cl3O |
|---|---|
| Molecular weight | 209.5 g/mol |
| IUPAC name | 2,3,6-trichlorobenzaldehyde |
| InChIKey | AURSMWWOMOVHBM-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Cl)C=O)Cl)Cl |
Computed by PubChem (NCBI)