2,3-Dichloropyridine-5-boronic acid, 95%
cas: 1072944-15-0 — see every product listed under this CAS number, including other names
2,3-Dichloropyridine-5-boronic acid, 95% (CAS 1072944-15-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100mg, 250mg. Offered by: Fluorochem, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F233190-1G |
| cas | 1072944-15-0 |
| size | 1g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 325.94 Pln | |
| Fluorochem | 5g | 883.04 Pln | |
| Fluorochem | 10g | 1684.84 Pln | |
| Fluorochem | 25g | 2648.04 Pln | |
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 126.80 Pln | |
| Chemat | 1g | 285.20 Pln | |
| Chemat | 5g | 808.40 Pln | |
| Chemat | 10g | 1552.40 Pln | |
| Chemat | 25g | 2306.00 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(5,6-dichloro-3-pyridinyl)boronic acid (CAS 1072944-15-0) is a chemical compound with the molecular formula C5H4BCl2NO2 and a molecular weight of 191.81 g/mol. IUPAC name: (5,6-dichloro-3-pyridinyl)boronic acid. InChIKey: DRJYUOQTLCPXHE-UHFFFAOYSA-N.
| Molecular formula | C5H4BCl2NO2 |
|---|---|
| Molecular weight | 191.81 g/mol |
| IUPAC name | (5,6-dichloro-3-pyridinyl)boronic acid |
| InChIKey | DRJYUOQTLCPXHE-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(N=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)