CAS 148493-34-9 appears in our catalog under these names: 2,6–Dichloropyridine–3–boronic acid, 2,6-Dichloropyridine-3-boronic acid, 95% , 2,6-Dichloropyridine-3-boronic Acid (contains varying amounts of Anhydride), 2,6-Dichloropyridin-3-ylboronic acid 97%, 2,6-Dichloropyridine-3-boronic acid, 97%, 97%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Chemat. Available pack sizes: 25g, 5g, 1g, 250mg, 10g, 100g, 50g, 10 g.
(2,6-dichloro-3-pyridinyl)boronic acid (CAS 148493-34-9) is a chemical compound with the molecular formula C5H4BCl2NO2 and a molecular weight of 191.81 g/mol. IUPAC name: (2,6-dichloro-3-pyridinyl)boronic acid. InChIKey: XBBLBQZAVMHEER-UHFFFAOYSA-N.
| Molecular formula | C5H4BCl2NO2 |
|---|---|
| Molecular weight | 191.81 g/mol |
| IUPAC name | (2,6-dichloro-3-pyridinyl)boronic acid |
| InChIKey | XBBLBQZAVMHEER-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=C(C=C1)Cl)Cl)(O)O |
Computed by PubChem (NCBI)