Products 951677-39-7

CAS 951677-39-7 appears in our catalog under these names: 2,3–Dichloropyridine–4–boronic Acid (contains varying amounts of Anhydride), 2,3-Dichloropyridine-4-boronic Acid (contains varying amounts of Anhydride), 2,3-Dichloropyridine-4-boronic acid 95%, 2,3-Dichloropyridine-4-Boronic Acid, 95%+, 95%+, 2,3-Dichloropyridine-4-boronic acid, 97%. Offered by: GLPBio, TCI, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g, 250mg, 100g.

Structural formula: {0} (CAS {1})

(2,3-dichloro-4-pyridinyl)boronic acid (CAS 951677-39-7) is a chemical compound with the molecular formula C5H4BCl2NO2 and a molecular weight of 191.81 g/mol. IUPAC name: (2,3-dichloro-4-pyridinyl)boronic acid. InChIKey: ABRTZUPJNVJMHP-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BCl2NO2
Molecular weight191.81 g/mol
IUPAC name(2,3-dichloro-4-pyridinyl)boronic acid
InChIKeyABRTZUPJNVJMHP-UHFFFAOYSA-N
SMILESB(C1=C(C(=NC=C1)Cl)Cl)(O)O

Computed by PubChem (NCBI)