Products 1072944-15-0

CAS 1072944-15-0 appears in our catalog under these names: 2,3-Dichloropyridine-5-boronic acid, 2,3–Dichloropyridine–5–boronic acid, 2,3-Dichloropyridine-5-boronic acid 97%, 2,3-Dichloropyridine-5-boronic acid, 95%, 95%, 2,3-Dichloropyridine-5-boronic acid, 95%. Offered by: TRC, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 10g, 1g, 25g, 5g, 100mg.

Structural formula: {0} (CAS {1})

(5,6-dichloro-3-pyridinyl)boronic acid (CAS 1072944-15-0) is a chemical compound with the molecular formula C5H4BCl2NO2 and a molecular weight of 191.81 g/mol. IUPAC name: (5,6-dichloro-3-pyridinyl)boronic acid. InChIKey: DRJYUOQTLCPXHE-UHFFFAOYSA-N.

Identity
Molecular formulaC5H4BCl2NO2
Molecular weight191.81 g/mol
IUPAC name(5,6-dichloro-3-pyridinyl)boronic acid
InChIKeyDRJYUOQTLCPXHE-UHFFFAOYSA-N
SMILESB(C1=CC(=C(N=C1)Cl)Cl)(O)O

Computed by PubChem (NCBI)