2,3-Difluoro-4-(methoxycarbonyl)phenylboronic acid, 98%, 98%
cas: 1402238-29-2 — see every product listed under this CAS number, including other names
2,3-Difluoro-4-(methoxycarbonyl)phenylboronic acid, 98%, 98% (CAS 1402238-29-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110BS1-100mg |
| cas | 1402238-29-2 |
| size | 100mg |
| availability | 5g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 386.00 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1360.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,3-difluoro-4-methoxycarbonylphenyl)boronic acid (CAS 1402238-29-2) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (2,3-difluoro-4-methoxycarbonylphenyl)boronic acid. InChIKey: DNIOTHIAVRFCFK-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (2,3-difluoro-4-methoxycarbonylphenyl)boronic acid |
| InChIKey | DNIOTHIAVRFCFK-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)C(=O)OC)F)F)(O)O |
Computed by PubChem (NCBI)