cas: 2377608-12-1 — see every product listed under this CAS number, including other names
2,3-Difluoro-5-(methoxycarbonyl)phenylboronic acid, 97%, 97% (CAS 2377608-12-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11JN64-250mg |
| cas | 2377608-12-1 |
| size | 250mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 712.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,3-difluoro-5-methoxycarbonylphenyl)boronic acid (CAS 2377608-12-1) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (2,3-difluoro-5-methoxycarbonylphenyl)boronic acid. InChIKey: KHRAKJPXWZQQRU-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (2,3-difluoro-5-methoxycarbonylphenyl)boronic acid |
| InChIKey | KHRAKJPXWZQQRU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1F)F)C(=O)OC)(O)O |
Computed by PubChem (NCBI)