cas: 1003709-96-3 — see every product listed under this CAS number, including other names
2,3-Difluoro-5-methylbenzoic acid 97% (CAS 1003709-96-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A620327-250mg |
| cas | 1003709-96-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 915.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A620327 |
2,3-difluoro-5-methylbenzoic acid (CAS 1003709-96-3) is a chemical compound with the molecular formula C8H6F2O2 and a molecular weight of 172.13 g/mol. IUPAC name: 2,3-difluoro-5-methylbenzoic acid. InChIKey: PJDCKKOTZDVVOV-UHFFFAOYSA-N.
| Molecular formula | C8H6F2O2 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2,3-difluoro-5-methylbenzoic acid |
| InChIKey | PJDCKKOTZDVVOV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)F)F)C(=O)O |
Computed by PubChem (NCBI)