cas: 1119455-04-7 — see every product listed under this CAS number, including other names
2,3-Difluoro-5-nitrophenol, 98% (CAS 1119455-04-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A119044-5g |
| cas | 1119455-04-7 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8194.48 Pln | |
| AmBeed | 10g | 9900.10 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,3-difluoro-5-nitrophenol (CAS 1119455-04-7) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 2,3-difluoro-5-nitrophenol. InChIKey: QEBOTENBPZWUEC-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 2,3-difluoro-5-nitrophenol |
| InChIKey | QEBOTENBPZWUEC-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)F)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)