CAS 139548-97-3 appears in our catalog under these names: 3,6–Difluoro–2–nitrophenol, 3,6-Difluoro-2-nitrophenol 98%, 3,6-Difluoro-2-nitrophenol, 98%, 98%, 3,6-DIFLUORO-2-NITROPHENOL, 98%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g, 25g.
3,6-difluoro-2-nitrophenol (CAS 139548-97-3) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 3,6-difluoro-2-nitrophenol. InChIKey: LDAORTVYRIJMQH-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 3,6-difluoro-2-nitrophenol |
| InChIKey | LDAORTVYRIJMQH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1F)[N+](=O)[O-])O)F |
Computed by PubChem (NCBI)