cas: 211693-73-1 — see every product listed under this CAS number, including other names
2,3-Difluoro-6-nitroaniline 97% (CAS 211693-73-1) is a chemical reagent available from Chemat. Available pack sizes: 1000g, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A368274-1000g |
| cas | 211693-73-1 |
| size | 1000g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1000g | 2283.88 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 220.19 Pln | |
| Ambeed | 10g | 253.56 Pln | |
| Ambeed | 25g | 292.50 Pln | |
| Ambeed | 100g | 348.12 Pln | |
| Ambeed | 500g | 1455.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A368274 |
2,3-difluoro-6-nitroaniline (CAS 211693-73-1) is a chemical compound with the molecular formula C6H4F2N2O2 and a molecular weight of 174.10 g/mol. IUPAC name: 2,3-difluoro-6-nitroaniline. InChIKey: DIPGYZSCGXBTEU-UHFFFAOYSA-N.
| Molecular formula | C6H4F2N2O2 |
|---|---|
| Molecular weight | 174.10 g/mol |
| IUPAC name | 2,3-difluoro-6-nitroaniline |
| InChIKey | DIPGYZSCGXBTEU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])N)F)F |
Computed by PubChem (NCBI)