cas: 82419-26-9 — see every product listed under this CAS number, including other names
2,3-Difluoro-6-nitrophenol, >98.0%(GC)(T) (CAS 82419-26-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D2705-5G |
| cas | 82419-26-9 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 260.95 Pln | |
| TCI | 25g | 777.26 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2,3-difluoro-6-nitrophenol (CAS 82419-26-9) is a chemical compound with the molecular formula C6H3F2NO3 and a molecular weight of 175.09 g/mol. IUPAC name: 2,3-difluoro-6-nitrophenol. InChIKey: KEGOHDCHURMFKX-UHFFFAOYSA-N.
| Molecular formula | C6H3F2NO3 |
|---|---|
| Molecular weight | 175.09 g/mol |
| IUPAC name | 2,3-difluoro-6-nitrophenol |
| InChIKey | KEGOHDCHURMFKX-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1[N+](=O)[O-])O)F)F |
Computed by PubChem (NCBI)