cas: 208173-20-0 — see every product listed under this CAS number, including other names
2,3-Difluorobenzophenone (CAS 208173-20-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 10g, 50g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F004783-1G |
| cas | 208173-20-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 10g | 778.91 Pln | |
| Fluorochem | 50g | 2851.10 Pln |
| delivery time | 2-3 weeks |
|---|
(2,3-difluorophenyl)-phenylmethanone (CAS 208173-20-0) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: (2,3-difluorophenyl)-phenylmethanone. InChIKey: BWQOPMJTQPWHOZ-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (2,3-difluorophenyl)-phenylmethanone |
| InChIKey | BWQOPMJTQPWHOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C(=CC=C2)F)F |
Computed by PubChem (NCBI)