CAS 85068-36-6 appears in our catalog under these names: 2,5-Difluorobenzophenone, 95%, (2,5-Difluorophenyl)(phenyl)methanone, 98%, 2,5–Difluorobenzophenone, 2,5-Difluorobenzophenone, >96.0%(GC), (2,5-Difluorophenyl)phenylmethanone. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 25g, 100g, 1g, 5g.
(2,5-difluorophenyl)-phenylmethanone (CAS 85068-36-6) is a chemical compound with the molecular formula C13H8F2O and a molecular weight of 218.20 g/mol. IUPAC name: (2,5-difluorophenyl)-phenylmethanone. InChIKey: HSCUAAMDKDZZKG-UHFFFAOYSA-N.
| Molecular formula | C13H8F2O |
|---|---|
| Molecular weight | 218.20 g/mol |
| IUPAC name | (2,5-difluorophenyl)-phenylmethanone |
| InChIKey | HSCUAAMDKDZZKG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=C(C=CC(=C2)F)F |
Computed by PubChem (NCBI)