cas: 4739-94-0 — see every product listed under this CAS number, including other names
2,3-Dihydro-benzo[1,4]dioxine-2-carboxylic acidethyl ester, 97% (CAS 4739-94-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F049583-5G |
| cas | 4739-94-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 143.72 Pln | |
| Fluorochem | 10g | 221.81 Pln | |
| Fluorochem | 25g | 362.39 Pln | |
| Fluorochem | 100g | 544.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2,3-dihydro-1,4-benzodioxine-3-carboxylate (CAS 4739-94-0) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: ethyl 2,3-dihydro-1,4-benzodioxine-3-carboxylate. InChIKey: DDIGEMWIKJMEIU-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | ethyl 2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| InChIKey | DDIGEMWIKJMEIU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1COC2=CC=CC=C2O1 |
Computed by PubChem (NCBI)