cas: 4739-94-0 — see every product listed under this CAS number, including other names
Ethyl 2,3-dihydrobenzo[1,4]dioxine-2-carboxylate, 97%, 97% (CAS 4739-94-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1181R2-1g |
| cas | 4739-94-0 |
| size | 1g |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 102.80 Pln | |
| Chemat | 5g | 117.20 Pln | |
| Chemat | 10g | 174.80 Pln | |
| Chemat | 25g | 338.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Ethyl 2,3-dihydro-1,4-benzodioxine-3-carboxylate (CAS 4739-94-0) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: ethyl 2,3-dihydro-1,4-benzodioxine-3-carboxylate. InChIKey: DDIGEMWIKJMEIU-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | ethyl 2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| InChIKey | DDIGEMWIKJMEIU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1COC2=CC=CC=C2O1 |
Computed by PubChem (NCBI)