cas: 4739-94-0 — see every product listed under this CAS number, including other names
Ethyl 2,3-dihydrobenzo[1,4]dioxine-2-carboxylate 95% (CAS 4739-94-0) is a chemical reagent available from Chemat. Available pack sizes: 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A447938-100g |
| cas | 4739-94-0 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100g | 726.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A447938 |
Ethyl 2,3-dihydro-1,4-benzodioxine-3-carboxylate (CAS 4739-94-0) is a chemical compound with the molecular formula C11H12O4 and a molecular weight of 208.21 g/mol. IUPAC name: ethyl 2,3-dihydro-1,4-benzodioxine-3-carboxylate. InChIKey: DDIGEMWIKJMEIU-UHFFFAOYSA-N.
| Molecular formula | C11H12O4 |
|---|---|
| Molecular weight | 208.21 g/mol |
| IUPAC name | ethyl 2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| InChIKey | DDIGEMWIKJMEIU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1COC2=CC=CC=C2O1 |
Computed by PubChem (NCBI)