cas: 89-01-0 — see every product listed under this CAS number, including other names
2,3-Pyrazine dicarboxylic acid, 98% (CAS 89-01-0) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F034759-25G |
| cas | 89-01-0 |
| size | 25g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 25g | 102.07 Pln | |
| Fluorochem | 100g | 185.37 Pln | |
| Fluorochem | 500g | 612.30 Pln | |
| Fluorochem | 1kg | 1169.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Pyrazine-2,3-dicarboxylic acid (CAS 89-01-0) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyrazine-2,3-dicarboxylic acid. InChIKey: ZUCRGHABDDWQPY-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyrazine-2,3-dicarboxylic acid |
| InChIKey | ZUCRGHABDDWQPY-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)