cas: 89-01-0 — see every product listed under this CAS number, including other names
2,3-Pyrazinedicarboxylic Acid, >98.0%(HPLC)(T) (CAS 89-01-0) is a chemical reagent available from Chemat. Available pack sizes: 25g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | P0545-25G |
| cas | 89-01-0 |
| size | 25g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 25g | 226.52 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(HPLC)(T) |
Pyrazine-2,3-dicarboxylic acid (CAS 89-01-0) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyrazine-2,3-dicarboxylic acid. InChIKey: ZUCRGHABDDWQPY-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyrazine-2,3-dicarboxylic acid |
| InChIKey | ZUCRGHABDDWQPY-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)