cas: 89-01-0 — see every product listed under this CAS number, including other names
Pyrazine-2,3-dicarboxylic acid, 99.97% (CAS 89-01-0) is a chemical reagent available from Chemat. Available pack sizes: 100 g, 500 g, 250 g, 50 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-W017105-100 g |
| cas | 89-01-0 |
| size | 100 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 100 g | 361.49 Pln | |
| MedChemExpress | 500 g | 793.38 Pln | |
| MedChemExpress | 250 g | 565.82 Pln | |
| MedChemExpress | 50 g | 277.90 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 99.97% |
Pyrazine-2,3-dicarboxylic acid (CAS 89-01-0) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyrazine-2,3-dicarboxylic acid. InChIKey: ZUCRGHABDDWQPY-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyrazine-2,3-dicarboxylic acid |
| InChIKey | ZUCRGHABDDWQPY-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)