cas: 89-01-0 — see every product listed under this CAS number, including other names
Pyrazine-2,3-dicarboxylic acid 98% (CAS 89-01-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A164253-5g |
| cas | 89-01-0 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 25g | 164.56 Pln | |
| Ambeed | 100g | 331.44 Pln | |
| Ambeed | 500g | 754.19 Pln | |
| Ambeed | 1000g | 1238.12 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A164253 |
Pyrazine-2,3-dicarboxylic acid (CAS 89-01-0) is a chemical compound with the molecular formula C6H4N2O4 and a molecular weight of 168.11 g/mol. IUPAC name: pyrazine-2,3-dicarboxylic acid. InChIKey: ZUCRGHABDDWQPY-UHFFFAOYSA-N.
| Molecular formula | C6H4N2O4 |
|---|---|
| Molecular weight | 168.11 g/mol |
| IUPAC name | pyrazine-2,3-dicarboxylic acid |
| InChIKey | ZUCRGHABDDWQPY-UHFFFAOYSA-N |
| SMILES | C1=CN=C(C(=N1)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)