CAS 606-12-2 appears in our catalog under these names: (2-Hydroxyphenyl)(4-hydroxyphenyl)methanone, 98%, 98%, 2,4'-Dihydroxybenzophenone, 95%, 2,4'-Dihydroxybenzophenone/ 99.77% (existing batch purity), 2,4'–Dihydroxybenzophenone, 2,4'-Dihydroxybenzophenone, >98.0%(GC). Offered by: Chemat, Combi-blocks, TargetMol, GLPBio, TCI. Available pack sizes: 250mg, 1g, 5g, 10mg, 25mg, 50mg, 100mg, 500mg.
(2-hydroxyphenyl)-(4-hydroxyphenyl)methanone (CAS 606-12-2) is a chemical compound with the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. IUPAC name: (2-hydroxyphenyl)-(4-hydroxyphenyl)methanone. InChIKey: HUYKZYIAFUBPAQ-UHFFFAOYSA-N.
| Molecular formula | C13H10O3 |
|---|---|
| Molecular weight | 214.22 g/mol |
| IUPAC name | (2-hydroxyphenyl)-(4-hydroxyphenyl)methanone |
| InChIKey | HUYKZYIAFUBPAQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)O)O |
Computed by PubChem (NCBI)