2,4,5-Trichloroquinoline, 98%
cas: 153749-72-5 — see every product listed under this CAS number, including other names
2,4,5-Trichloroquinoline, 98% (CAS 153749-72-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A920633-100mg |
| cas | 153749-72-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 820.94 Pln | |
| Ambeed | 1g | 2100.31 Pln | |
| BLDpharm | 100mg | 547.61 Pln | |
| BLDpharm | 250mg | 880.83 Pln | |
| BLDpharm | 1g | 2263.67 Pln | |
| Chemat | 100mg | 434.00 Pln | |
| Chemat | 250mg | 698.00 Pln | |
| Chemat | 1g | 1658.00 Pln | |
| Fluorochem | 100mg | 518.59 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
2,4,5-trichloroquinoline (CAS 153749-72-5) is a chemical compound with the molecular formula C9H4Cl3N and a molecular weight of 232.5 g/mol. IUPAC name: 2,4,5-trichloroquinoline. InChIKey: PVOFTAIVWVOBGR-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3N |
|---|---|
| Molecular weight | 232.5 g/mol |
| IUPAC name | 2,4,5-trichloroquinoline |
| InChIKey | PVOFTAIVWVOBGR-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)