cas: 112811-65-1 — see every product listed under this CAS number, including other names
2,4,5-Trifluoro-3-methoxybenzoic acid, 97% (CAS 112811-65-1) is a chemical reagent available from Chemat. Available pack sizes: 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F009272-100G |
| cas | 112811-65-1 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100g | 164.54 Pln | |
| Fluorochem | 500g | 518.59 Pln | |
| Fluorochem | 1kg | 987.17 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
2,4,5-trifluoro-3-methoxybenzoic acid (CAS 112811-65-1) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2,4,5-trifluoro-3-methoxybenzoic acid. InChIKey: YVJHZWWMKFQKDC-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2,4,5-trifluoro-3-methoxybenzoic acid |
| InChIKey | YVJHZWWMKFQKDC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1F)F)C(=O)O)F |
Computed by PubChem (NCBI)