cas: 112811-65-1 — see every product listed under this CAS number, including other names
Moxidectin Impurity 5 98% (CAS 112811-65-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A129143-5g |
| cas | 112811-65-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 120.06 Pln | |
| Ambeed | 10g | 131.19 Pln | |
| Ambeed | 25g | 147.88 Pln | |
| Ambeed | 100g | 192.38 Pln | |
| Ambeed | 500g | 576.19 Pln | |
| Ambeed | 1000g | 1076.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A129143 |
2,4,5-trifluoro-3-methoxybenzoic acid (CAS 112811-65-1) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2,4,5-trifluoro-3-methoxybenzoic acid. InChIKey: YVJHZWWMKFQKDC-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2,4,5-trifluoro-3-methoxybenzoic acid |
| InChIKey | YVJHZWWMKFQKDC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1F)F)C(=O)O)F |
Computed by PubChem (NCBI)