cas: 112811-65-1 — see every product listed under this CAS number, including other names
2,4,5-Trifluoro-3-methoxybenzoic acid, 98%, 98% (CAS 112811-65-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HCFL-5g |
| cas | 112811-65-1 |
| size | 5g |
| availability | 6500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 78.80 Pln | |
| Chemat | 100g | 136.40 Pln | |
| Chemat | 500g | 499.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4,5-trifluoro-3-methoxybenzoic acid (CAS 112811-65-1) is a chemical compound with the molecular formula C8H5F3O3 and a molecular weight of 206.12 g/mol. IUPAC name: 2,4,5-trifluoro-3-methoxybenzoic acid. InChIKey: YVJHZWWMKFQKDC-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O3 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | 2,4,5-trifluoro-3-methoxybenzoic acid |
| InChIKey | YVJHZWWMKFQKDC-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=CC(=C1F)F)C(=O)O)F |
Computed by PubChem (NCBI)