2,4,6-Trichloroquinoline, 95%
cas: 1677-50-5 — see every product listed under this CAS number, including other names
2,4,6-Trichloroquinoline, 95% (CAS 1677-50-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 5g, 100mg, 1g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A734319-250mg |
| cas | 1677-50-5 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 798.69 Pln | |
| Ambeed | 5g | 5966.25 Pln | |
| BLDpharm | 100mg | 530.95 Pln | |
| BLDpharm | 250mg | 858.61 Pln | |
| BLDpharm | 1g | 2185.92 Pln | |
| BLDpharm | 5g | 6428.87 Pln | |
| Chemat | 100mg | 371.60 Pln | |
| Chemat | 250mg | 592.40 Pln | |
| Chemat | 1g | 1490.00 Pln | |
| Chemat | 5g | 4341.20 Pln | |
| Fluorochem | 1g | 2767.79 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
2,4,6-trichloroquinoline (CAS 1677-50-5) is a chemical compound with the molecular formula C9H4Cl3N and a molecular weight of 232.5 g/mol. IUPAC name: 2,4,6-trichloroquinoline. InChIKey: ALESUIVUHLTNLB-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3N |
|---|---|
| Molecular weight | 232.5 g/mol |
| IUPAC name | 2,4,6-trichloroquinoline |
| InChIKey | ALESUIVUHLTNLB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)