cas: 570-02-5 — see every product listed under this CAS number, including other names
2,4,6-Trimethoxybenzoic Acid, >98.0%(GC)(T) (CAS 570-02-5) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T2408-5G |
| cas | 570-02-5 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 1057.54 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(GC)(T) |
2,4,6-trimethoxybenzoic acid (CAS 570-02-5) is a chemical compound with the molecular formula C10H12O5 and a molecular weight of 212.20 g/mol. IUPAC name: 2,4,6-trimethoxybenzoic acid. InChIKey: JATAKEDDMQNPOQ-UHFFFAOYSA-N.
| Molecular formula | C10H12O5 |
|---|---|
| Molecular weight | 212.20 g/mol |
| IUPAC name | 2,4,6-trimethoxybenzoic acid |
| InChIKey | JATAKEDDMQNPOQ-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)C(=O)O)OC |
Computed by PubChem (NCBI)