2,4,7-Trichloroquinoline, 98%
cas: 1677-49-2 — see every product listed under this CAS number, including other names
2,4,7-Trichloroquinoline, 98% (CAS 1677-49-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 100g, 10g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch112XJL-100mg |
| cas | 1677-49-2 |
| size | 100mg |
| availability | 500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 179.60 Pln | |
| Chemat | 250mg | 256.40 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1355.60 Pln | |
| Chemat | 100g | 25360.40 Pln | |
| Fluorochem | 250mg | 289.50 Pln | |
| Fluorochem | 1g | 669.57 Pln | |
| Fluorochem | 5g | 1893.10 Pln | |
| Fluorochem | 10g | 3340.51 Pln | |
| Fluorochem | 25g | 7229.76 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2,4,7-trichloroquinoline (CAS 1677-49-2) is a chemical compound with the molecular formula C9H4Cl3N and a molecular weight of 232.5 g/mol. IUPAC name: 2,4,7-trichloroquinoline. InChIKey: NIESTINBJGQKPB-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl3N |
|---|---|
| Molecular weight | 232.5 g/mol |
| IUPAC name | 2,4,7-trichloroquinoline |
| InChIKey | NIESTINBJGQKPB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)