cas: 61566-58-3 — see every product listed under this CAS number, including other names
2,4-Diaminobenzoic acid dihydrochloride, 98+% (CAS 61566-58-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A859948-250mg |
| cas | 61566-58-3 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 1306.90 Pln | |
| AmBeed | 100mg | 857.71 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
2,4-diaminobenzoic acid;dihydrochloride (CAS 61566-58-3) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: 2,4-diaminobenzoic acid;dihydrochloride. InChIKey: LAVHFNVUGYKNGS-UHFFFAOYSA-N.
| Molecular formula | C7H10Cl2N2O2 |
|---|---|
| Molecular weight | 225.07 g/mol |
| IUPAC name | 2,4-diaminobenzoic acid;dihydrochloride |
| InChIKey | LAVHFNVUGYKNGS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1N)N)C(=O)O.Cl.Cl |
Computed by PubChem (NCBI)