Products 2230807-60-8

CAS 2230807-60-8 is the registry number for 2-(Aminomethyl)pyridine-3-carboxylic acid dihydrochloride. Offered by: Biosynth. Available pack sizes: 25mg.

Structural formula: {0} (CAS {1})

2-(aminomethyl)pyridine-3-carboxylic acid;dihydrochloride (CAS 2230807-60-8) is a chemical compound with the molecular formula C7H10Cl2N2O2 and a molecular weight of 225.07 g/mol. IUPAC name: 2-(aminomethyl)pyridine-3-carboxylic acid;dihydrochloride. InChIKey: TXQIOUVSZGWBBL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H10Cl2N2O2
Molecular weight225.07 g/mol
IUPAC name2-(aminomethyl)pyridine-3-carboxylic acid;dihydrochloride
InChIKeyTXQIOUVSZGWBBL-UHFFFAOYSA-N
SMILESC1=CC(=C(N=C1)CN)C(=O)O.Cl.Cl

Computed by PubChem (NCBI)