2,4-Dichloro-3-isocyanato-1,5-dimethoxybenzene, 97%
cas: 872511-32-5 — see every product listed under this CAS number, including other names
2,4-Dichloro-3-isocyanato-1,5-dimethoxybenzene, 97% (CAS 872511-32-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch12FWHW-100mg |
| cas | 872511-32-5 |
| size | 100mg |
| availability | 125g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 165.20 Pln | |
| Chemat | 250mg | 237.20 Pln | |
| Chemat | 500mg | 410.00 Pln | |
| Chemat | 1g | 530.00 Pln | |
| Chemat | 5g | 2003.60 Pln | |
| Chemat | 25g | 6851.60 Pln | |
| Fluorochem | 500mg | 742.46 Pln | |
| Fluorochem | 100mg | 279.09 Pln | |
| Fluorochem | 250mg | 414.46 Pln | |
| Fluorochem | 1g | 966.34 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
2,4-dichloro-3-isocyanato-1,5-dimethoxybenzene (CAS 872511-32-5) is a chemical compound with the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. IUPAC name: 2,4-dichloro-3-isocyanato-1,5-dimethoxybenzene. InChIKey: VJFDWELAHZSVEE-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO3 |
|---|---|
| Molecular weight | 248.06 g/mol |
| IUPAC name | 2,4-dichloro-3-isocyanato-1,5-dimethoxybenzene |
| InChIKey | VJFDWELAHZSVEE-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1Cl)N=C=O)Cl)OC |
Computed by PubChem (NCBI)
Synonyms:
2,6-Dichloro-3,5-dimethoxyphenyl isocyanate, 2,4-dichloro-3-isocyanato-1,5-dimethoxybenzene, 2,4-Dichloro-3-isocyanato-1,5-dimethoxy-benzene, 2,6-dichloro-3,5-dimethoxyphenylisocyanate, Benzene, 2,4-dichloro-3-isocyanato-1,5-dimethoxy-, 2,6-dichloro-, VJFDWELAHZSVEE-UHFFFAOYSA-N, 2,6-dichloro-3,5-dimethoxyphenyl-isocyanate