CAS 930395-66-7 is the registry number for 2-Chloro-N-(6-chloro-2H-1,3-benzodioxol-5-yl)acetamide, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)acetamide (CAS 930395-66-7) is a chemical compound with the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. IUPAC name: 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)acetamide. InChIKey: SDGJAQZTFXWSLN-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO3 |
|---|---|
| Molecular weight | 248.06 g/mol |
| IUPAC name | 2-chloro-N-(6-chloro-1,3-benzodioxol-5-yl)acetamide |
| InChIKey | SDGJAQZTFXWSLN-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)NC(=O)CCl)Cl |
Computed by PubChem (NCBI)