Products 869950-77-6
CAS 869950-77-6 is the registry number for 2-Chloro-5-[(chloroacetyl)amino]benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
2-chloro-5-[(2-chloroacetyl)amino]benzoic acid (CAS 869950-77-6) is a chemical compound with the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. IUPAC name: 2-chloro-5-[(2-chloroacetyl)amino]benzoic acid. InChIKey: AMMJNLFFBNGTJU-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO3 |
|---|---|
| Molecular weight | 248.06 g/mol |
| IUPAC name | 2-chloro-5-[(2-chloroacetyl)amino]benzoic acid |
| InChIKey | AMMJNLFFBNGTJU-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)CCl)C(=O)O)Cl |
Computed by PubChem (NCBI)