CAS 17321-80-1 appears in our catalog under these names: 2-[(3,4-Dichlorobenzoyl)amino]acetic acid, 95%, 2-((3,4-Dichlorobenzoyl)amino)acetic acid, 2-(3,4-Dichlorobenzamido)acetic acid 96%, 2-[(3,4-dichlorophenyl)formamido]acetic acid, 95%. Offered by: Combi-blocks, Biosynth, Ambeed, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 2,5g, 100mg.
2-[(3,4-dichlorobenzoyl)amino]acetic acid (CAS 17321-80-1) is a chemical compound with the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. IUPAC name: 2-[(3,4-dichlorobenzoyl)amino]acetic acid. InChIKey: TVWQKCYNJSKYOP-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO3 |
|---|---|
| Molecular weight | 248.06 g/mol |
| IUPAC name | 2-[(3,4-dichlorobenzoyl)amino]acetic acid |
| InChIKey | TVWQKCYNJSKYOP-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)NCC(=O)O)Cl)Cl |
Computed by PubChem (NCBI)