Products 53219-94-6

CAS 53219-94-6 is the registry number for 3-[(3,5-Dichlorophenyl)amino]-3-oxopropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3-(3,5-dichloroanilino)-3-oxopropanoic acid (CAS 53219-94-6) is a chemical compound with the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. IUPAC name: 3-(3,5-dichloroanilino)-3-oxopropanoic acid. InChIKey: NELMPJIYQJFINV-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7Cl2NO3
Molecular weight248.06 g/mol
IUPAC name3-(3,5-dichloroanilino)-3-oxopropanoic acid
InChIKeyNELMPJIYQJFINV-UHFFFAOYSA-N
SMILESC1=C(C=C(C=C1Cl)Cl)NC(=O)CC(=O)O

Computed by PubChem (NCBI)