CAS 53219-94-6 is the registry number for 3-[(3,5-Dichlorophenyl)amino]-3-oxopropanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(3,5-dichloroanilino)-3-oxopropanoic acid (CAS 53219-94-6) is a chemical compound with the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. IUPAC name: 3-(3,5-dichloroanilino)-3-oxopropanoic acid. InChIKey: NELMPJIYQJFINV-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO3 |
|---|---|
| Molecular weight | 248.06 g/mol |
| IUPAC name | 3-(3,5-dichloroanilino)-3-oxopropanoic acid |
| InChIKey | NELMPJIYQJFINV-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)NC(=O)CC(=O)O |
Computed by PubChem (NCBI)