Products 50917-27-6
CAS 50917-27-6 appears in our catalog under these names: 2,4-Dichloro-3-acetamidobenzoic acid, 95%, 3-Acetamido-2,4-dichlorobenzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 25g, 5g.
3-acetamido-2,4-dichlorobenzoic acid (CAS 50917-27-6) is a chemical compound with the molecular formula C9H7Cl2NO3 and a molecular weight of 248.06 g/mol. IUPAC name: 3-acetamido-2,4-dichlorobenzoic acid. InChIKey: JTNUYPZFVNHVGY-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2NO3 |
|---|---|
| Molecular weight | 248.06 g/mol |
| IUPAC name | 3-acetamido-2,4-dichlorobenzoic acid |
| InChIKey | JTNUYPZFVNHVGY-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=CC(=C1Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)